C7H10FNO2 — CID 175401711
2-(3-fluoropiperidin-4-ylidene)acetic acid (PubChem CID 175401711) has the molecular formula C7H10FNO2 and a molecular weight of 159.16 g/mol. Its IUPAC name is 2-(3-fluoropiperidin-4-ylidene)acetic acid.
| Compound Name | 2-(3-fluoropiperidin-4-ylidene)acetic acid |
|---|---|
| PubChem CID | 175401711 |
| Molecular Formula | C7H10FNO2 |
| Molecular Weight | 159.16 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 2-(3-fluoropiperidin-4-ylidene)acetic acid |
| SMILES | O=C(O)C=C1CCNCC1F |
| InChI | InChI=1S/C7H10FNO2/c8-6-4-9-2-1-5(6)3-7(10)11/h3,6,9H,1-2,4H2,(H,10,11) |
| InChIKey | VUTMLHAFRAXLQJ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.16 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|