C40H30F6O10S2 — CID 155658664
methyl 3-methyl-2-[4-[(E)-2-[3-(trifluoromethylsulfonyloxy)-1H-inden-4-yl]ethenyl]benzoyl]oxy-4-[2-[3-(trifluoromethylsulfonyloxy)-1H-inden-4-yl]ethyl]benzoate (PubChem CID 155658664) has the molecular formula C40H30F6O10S2 and a molecular weight of 848.79 g/mol. Its IUPAC name is methyl 3-methyl-2-[4-[(E)-2-[3-(trifluoromethylsulfonyloxy)-1H-inden-4-yl]ethenyl]benzoyl]oxy-4-[2-[3-(trifluoromethylsulfonyloxy)-1H-inden-4-yl]ethyl]benzoate.
| Compound Name | methyl 3-methyl-2-[4-[(E)-2-[3-(trifluoromethylsulfonyloxy)-1H-inden-4-yl]ethenyl]benzoyl]oxy-4-[2-[3-(trifluoromethylsulfonyloxy)-1H-inden-4-yl]ethyl]benzoate |
|---|---|
| PubChem CID | 155658664 |
| Molecular Formula | C40H30F6O10S2 |
| Molecular Weight | 848.79 g/mol |
| Exact Mass | 848.12 |
| IUPAC Name | methyl 3-methyl-2-[4-[(E)-2-[3-(trifluoromethylsulfonyloxy)-1H-inden-4-yl]ethenyl]benzoyl]oxy-4-[2-[3-(trifluoromethylsulfonyloxy)-1H-inden-4-yl]ethyl]benzoate |
| SMILES | COC(=O)c1ccc(CCc2cccc3c2C(OS(=O)(=O)C(F)(F)F)=CC3)c(C)c1OC(=O)c1ccc(/C=C/c2cccc3c2C(OS(=O)(=O)C(F)(F)F)=CC3)cc1 |
| InChI | InChI=1S/C40H30F6O10S2/c1-23-25(15-16-27-6-4-8-29-19-22-33(35(27)29)56-58(51,52)40(44,45)46)17-20-31(38(48)53-2)36(23)54-37(47)30-13-10-24(11-14-30)9-12-26-5-3-7-28-18-21-32(34(26)28)55-57(49,50)39(41,42)43/h3-14,17,20-22H,15-16,18-19H2,1-2H3/b12-9+ |
| InChIKey | ZUMVVEDQVJWLQR-FMIVXFBMSA-N |
| XLogP | 8.48 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.79 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|