C36H45ClO6 — CID 155659934
cyclohexyl 5-[3-chloro-10-(5-cyclohexyloxy-5-oxopentoxy)anthracen-9-yl]oxypentanoate (PubChem CID 155659934) has the molecular formula C36H45ClO6 and a molecular weight of 609.20 g/mol. Its IUPAC name is cyclohexyl 5-[3-chloro-10-(5-cyclohexyloxy-5-oxopentoxy)anthracen-9-yl]oxypentanoate.
| Compound Name | cyclohexyl 5-[3-chloro-10-(5-cyclohexyloxy-5-oxopentoxy)anthracen-9-yl]oxypentanoate |
|---|---|
| PubChem CID | 155659934 |
| Molecular Formula | C36H45ClO6 |
| Molecular Weight | 609.20 g/mol |
| Exact Mass | 608.29 |
| IUPAC Name | cyclohexyl 5-[3-chloro-10-(5-cyclohexyloxy-5-oxopentoxy)anthracen-9-yl]oxypentanoate |
| SMILES | O=C(CCCCOc1c2ccccc2c(OCCCCC(=O)OC2CCCCC2)c2cc(Cl)ccc12)OC1CCCCC1 |
| InChI | InChI=1S/C36H45ClO6/c37-26-21-22-31-32(25-26)36(41-24-12-10-20-34(39)43-28-15-5-2-6-16-28)30-18-8-7-17-29(30)35(31)40-23-11-9-19-33(38)42-27-13-3-1-4-14-27/h7-8,17-18,21-22,25,27-28H,1-6,9-16,19-20,23-24H2 |
| InChIKey | SNSJWIFLHHCWBE-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.20 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|