C34H41ClO6 — CID 155659920
cyclohexylmethyl 3-[3-chloro-10-[3-(cyclohexylmethoxy)-3-oxopropoxy]anthracen-9-yl]oxypropanoate (PubChem CID 155659920) has the molecular formula C34H41ClO6 and a molecular weight of 581.15 g/mol. Its IUPAC name is cyclohexylmethyl 3-[3-chloro-10-[3-(cyclohexylmethoxy)-3-oxopropoxy]anthracen-9-yl]oxypropanoate.
| Compound Name | cyclohexylmethyl 3-[3-chloro-10-[3-(cyclohexylmethoxy)-3-oxopropoxy]anthracen-9-yl]oxypropanoate |
|---|---|
| PubChem CID | 155659920 |
| Molecular Formula | C34H41ClO6 |
| Molecular Weight | 581.15 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | cyclohexylmethyl 3-[3-chloro-10-[3-(cyclohexylmethoxy)-3-oxopropoxy]anthracen-9-yl]oxypropanoate |
| SMILES | O=C(CCOc1c2ccccc2c(OCCC(=O)OCC2CCCCC2)c2cc(Cl)ccc12)OCC1CCCCC1 |
| InChI | InChI=1S/C34H41ClO6/c35-26-15-16-29-30(21-26)34(39-20-18-32(37)41-23-25-11-5-2-6-12-25)28-14-8-7-13-27(28)33(29)38-19-17-31(36)40-22-24-9-3-1-4-10-24/h7-8,13-16,21,24-25H,1-6,9-12,17-20,22-23H2 |
| InChIKey | MOURWQGLLQUZER-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.15 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|