C32H37ClO6 — CID 155660078
cyclohexyl 3-[3-chloro-10-(3-cyclohexyloxy-3-oxopropoxy)anthracen-9-yl]oxypropanoate (PubChem CID 155660078) has the molecular formula C32H37ClO6 and a molecular weight of 553.10 g/mol. Its IUPAC name is cyclohexyl 3-[3-chloro-10-(3-cyclohexyloxy-3-oxopropoxy)anthracen-9-yl]oxypropanoate.
| Compound Name | cyclohexyl 3-[3-chloro-10-(3-cyclohexyloxy-3-oxopropoxy)anthracen-9-yl]oxypropanoate |
|---|---|
| PubChem CID | 155660078 |
| Molecular Formula | C32H37ClO6 |
| Molecular Weight | 553.10 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | cyclohexyl 3-[3-chloro-10-(3-cyclohexyloxy-3-oxopropoxy)anthracen-9-yl]oxypropanoate |
| SMILES | O=C(CCOc1c2ccccc2c(OCCC(=O)OC2CCCCC2)c2cc(Cl)ccc12)OC1CCCCC1 |
| InChI | InChI=1S/C32H37ClO6/c33-22-15-16-27-28(21-22)32(37-20-18-30(35)39-24-11-5-2-6-12-24)26-14-8-7-13-25(26)31(27)36-19-17-29(34)38-23-9-3-1-4-10-23/h7-8,13-16,21,23-24H,1-6,9-12,17-20H2 |
| InChIKey | KDOVPLGDQKXXBP-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.10 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|