C43H42F2N11O10P — CID 155661064
bis[(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-4-fluoro-2-(hydroxymethyl)-2-prop-2-enyloxolan-3-yl] 2-cyanoethyl phosphate (PubChem CID 155661064) has the molecular formula C43H42F2N11O10P and a molecular weight of 941.85 g/mol. Its IUPAC name is bis[(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-4-fluoro-2-(hydroxymethyl)-2-prop-2-enyloxolan-3-yl] 2-cyanoethyl phosphate.
| Compound Name | bis[(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-4-fluoro-2-(hydroxymethyl)-2-prop-2-enyloxolan-3-yl] 2-cyanoethyl phosphate |
|---|---|
| PubChem CID | 155661064 |
| Molecular Formula | C43H42F2N11O10P |
| Molecular Weight | 941.85 g/mol |
| Exact Mass | 941.28 |
| IUPAC Name | bis[(2R,3R,4R,5R)-5-(6-benzamidopurin-9-yl)-4-fluoro-2-(hydroxymethyl)-2-prop-2-enyloxolan-3-yl] 2-cyanoethyl phosphate |
| SMILES | C=CC[C@]1(CO)O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@H](F)[C@@H]1OP(=O)(OCCC#N)O[C@H]1[C@@H](F)[C@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)O[C@@]1(CO)CC=C |
| InChI | InChI=1S/C43H42F2N11O10P/c1-3-16-42(20-57)32(28(44)40(63-42)55-24-51-30-34(47-22-49-36(30)55)53-38(59)26-12-7-5-8-13-26)65-67(61,62-19-11-18-46)66-33-29(45)41(64-43(33,21-58)17-4-2)56-25-52-31-35(48-23-50-37(31)56)54-39(60)27-14-9-6-10-15-27/h3-10,12-15,22-25,28-29,32-33,40-41,57-58H,1-2,11,16-17,19-21H2,(H,47,49,53,59)(H,48,50,54,60)/t28-,29-,32+,33+,40-,41-,42-,43-/m1/s1 |
| InChIKey | YPDZUOYHJUYUGE-LIUPMCCDSA-N |
| XLogP | 5.33 |
| TPSA | 272.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 941.85 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|