C32H37N7O5 — CID 51361589
N-[9-[(2R,3R,4S,5R)-5-[3-[(1-benzylpiperidin-4-yl)methylamino]-3-oxopropyl]-3,4-dihydroxyoxolan-2-yl]purin-6-yl]benzamide (PubChem CID 51361589) has the molecular formula C32H37N7O5 and a molecular weight of 599.69 g/mol. Its IUPAC name is N-[9-[(2R,3R,4S,5R)-5-[3-[(1-benzylpiperidin-4-yl)methylamino]-3-oxopropyl]-3,4-dihydroxyoxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4S,5R)-5-[3-[(1-benzylpiperidin-4-yl)methylamino]-3-oxopropyl]-3,4-dihydroxyoxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 51361589 |
| Molecular Formula | C32H37N7O5 |
| Molecular Weight | 599.69 g/mol |
| Exact Mass | 599.29 |
| IUPAC Name | N-[9-[(2R,3R,4S,5R)-5-[3-[(1-benzylpiperidin-4-yl)methylamino]-3-oxopropyl]-3,4-dihydroxyoxolan-2-yl]purin-6-yl]benzamide |
| SMILES | O=C(CC[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@H](O)[C@@H]1O)NCC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C32H37N7O5/c40-25(33-17-21-13-15-38(16-14-21)18-22-7-3-1-4-8-22)12-11-24-27(41)28(42)32(44-24)39-20-36-26-29(34-19-35-30(26)39)37-31(43)23-9-5-2-6-10-23/h1-10,19-21,24,27-28,32,41-42H,11-18H2,(H,33,40)(H,34,35,37,43)/t24-,27-,28-,32-/m1/s1 |
| InChIKey | BQUXDZXNFSTBSZ-SLXDEKLDSA-N |
| XLogP | 2.51 |
| TPSA | 154.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.69 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |