About CID 155661823
CID 155661823 (PubChem CID 155661823) has the molecular formula C15H24ISi
and a molecular weight of 359.35 g/mol.
Molecular Properties
| Compound Name | CID 155661823 |
| PubChem CID | 155661823 |
| Molecular Formula | C15H24ISi |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | — |
| SMILES | CCC(C)(C)C[Si](I)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C15H24ISi/c1-6-14(2,3)12-17(16)15(4,5)13-10-8-7-9-11-13/h7-11H,6,12H2,1-5H3 |
| InChIKey | JXXOMCQGJOOBGH-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze CID 155661823 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155661823?
The IUPAC name of CID 155661823 (CID 155661823) is not available.
What is the SMILES notation for CID 155661823?
The canonical SMILES for CID 155661823 is CCC(C)(C)C[Si](I)C(C)(C)c1ccccc1.
What is the InChIKey of CID 155661823?
The InChIKey is JXXOMCQGJOOBGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24ISi/c1-6-14(2,3)12-17(16)15(4,5)13-10-8-7-9-11-13/h7-11H,6,12H2,1-5H3.
What are the key properties of CID 155661823?
CID 155661823 has a molecular weight of 359.35 g/mol, XLogP of 5.37, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155661823 is sourced from PubChem (CID 155661823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).