C17H14F2O3 — CID 155664258
2-[4-[(4-acetylphenyl)methyl]-2,6-difluorophenyl]acetic acid (PubChem CID 155664258) has the molecular formula C17H14F2O3 and a molecular weight of 304.29 g/mol. Its IUPAC name is 2-[4-[(4-acetylphenyl)methyl]-2,6-difluorophenyl]acetic acid.
| Compound Name | 2-[4-[(4-acetylphenyl)methyl]-2,6-difluorophenyl]acetic acid |
|---|---|
| PubChem CID | 155664258 |
| Molecular Formula | C17H14F2O3 |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-[4-[(4-acetylphenyl)methyl]-2,6-difluorophenyl]acetic acid |
| SMILES | CC(=O)c1ccc(Cc2cc(F)c(CC(=O)O)c(F)c2)cc1 |
| InChI | InChI=1S/C17H14F2O3/c1-10(20)13-4-2-11(3-5-13)6-12-7-15(18)14(9-17(21)22)16(19)8-12/h2-5,7-8H,6,9H2,1H3,(H,21,22) |
| InChIKey | KIFIKNFKHRAPIB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |