About quinolin-8-yl 3-phenyl-2-[(2-phenylacetyl)amino]propanoate
quinolin-8-yl 3-phenyl-2-[(2-phenylacetyl)amino]propanoate (PubChem CID 155665107) has the molecular formula C26H22N2O3
and a molecular weight of 410.47 g/mol. Its IUPAC name is quinolin-8-yl 3-phenyl-2-[(2-phenylacetyl)amino]propanoate.
Molecular Properties
| Compound Name | quinolin-8-yl 3-phenyl-2-[(2-phenylacetyl)amino]propanoate |
| PubChem CID | 155665107 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | quinolin-8-yl 3-phenyl-2-[(2-phenylacetyl)amino]propanoate |
| SMILES | O=C(Cc1ccccc1)NC(Cc1ccccc1)C(=O)Oc1cccc2cccnc12 |
| InChI | InChI=1S/C26H22N2O3/c29-24(18-20-11-5-2-6-12-20)28-22(17-19-9-3-1-4-10-19)26(30)31-23-15-7-13-21-14-8-16-27-25(21)23/h1-16,22H,17-18H2,(H,28,29) |
| InChIKey | SDLYUXBYNBBFGZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze quinolin-8-yl 3-phenyl-2-[(2-phenylacetyl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-8-yl 3-phenyl-2-[(2-phenylacetyl)amino]propanoate?
The IUPAC name of quinolin-8-yl 3-phenyl-2-[(2-phenylacetyl)amino]propanoate (CID 155665107) is quinolin-8-yl 3-phenyl-2-[(2-phenylacetyl)amino]propanoate.
What is the SMILES notation for quinolin-8-yl 3-phenyl-2-[(2-phenylacetyl)amino]propanoate?
The canonical SMILES for quinolin-8-yl 3-phenyl-2-[(2-phenylacetyl)amino]propanoate is O=C(Cc1ccccc1)NC(Cc1ccccc1)C(=O)Oc1cccc2cccnc12.
What is the InChIKey of quinolin-8-yl 3-phenyl-2-[(2-phenylacetyl)amino]propanoate?
The InChIKey is SDLYUXBYNBBFGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22N2O3/c29-24(18-20-11-5-2-6-12-20)28-22(17-19-9-3-1-4-10-19)26(30)31-23-15-7-13-21-14-8-16-27-25(21)23/h1-16,22H,17-18H2,(H,28,29).
What are the key properties of quinolin-8-yl 3-phenyl-2-[(2-phenylacetyl)amino]propanoate?
quinolin-8-yl 3-phenyl-2-[(2-phenylacetyl)amino]propanoate has a molecular weight of 410.47 g/mol, XLogP of 4.11, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-8-yl 3-phenyl-2-[(2-phenylacetyl)amino]propanoate is sourced from PubChem (CID 155665107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).