C21H24N2O — CID 155666618
1-N',1-N'-dimethyl-3-naphthalen-1-yloxy-1-phenylpropane-1,1-diamine (PubChem CID 155666618) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is 1-N',1-N'-dimethyl-3-naphthalen-1-yloxy-1-phenylpropane-1,1-diamine.
| Compound Name | 1-N',1-N'-dimethyl-3-naphthalen-1-yloxy-1-phenylpropane-1,1-diamine |
|---|---|
| PubChem CID | 155666618 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 1-N',1-N'-dimethyl-3-naphthalen-1-yloxy-1-phenylpropane-1,1-diamine |
| SMILES | CN(C)C(N)(CCOc1cccc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C21H24N2O/c1-23(2)21(22,18-11-4-3-5-12-18)15-16-24-20-14-8-10-17-9-6-7-13-19(17)20/h3-14H,15-16,22H2,1-2H3 |
| InChIKey | JXXJVTJKCHNDBX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|