C14H12ClF3N4O3 — CID 155666860
2-[(6-chloro-3-nitro-2-pyridinyl)-[[6-(trifluoromethyl)-3-pyridinyl]methyl]amino]ethanol (PubChem CID 155666860) has the molecular formula C14H12ClF3N4O3 and a molecular weight of 376.72 g/mol. Its IUPAC name is 2-[(6-chloro-3-nitro-2-pyridinyl)-[[6-(trifluoromethyl)-3-pyridinyl]methyl]amino]ethanol.
| Compound Name | 2-[(6-chloro-3-nitro-2-pyridinyl)-[[6-(trifluoromethyl)-3-pyridinyl]methyl]amino]ethanol |
|---|---|
| PubChem CID | 155666860 |
| Molecular Formula | C14H12ClF3N4O3 |
| Molecular Weight | 376.72 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 2-[(6-chloro-3-nitro-2-pyridinyl)-[[6-(trifluoromethyl)-3-pyridinyl]methyl]amino]ethanol |
| SMILES | O=[N+]([O-])c1ccc(Cl)nc1N(CCO)Cc1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C14H12ClF3N4O3/c15-12-4-2-10(22(24)25)13(20-12)21(5-6-23)8-9-1-3-11(19-7-9)14(16,17)18/h1-4,7,23H,5-6,8H2 |
| InChIKey | IPHHQSRIFMIAMW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 92.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.72 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|