C28H35N3O2S — CID 155670313
3-[3-[2-methyl-3-[2-methyl-3-(4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridin-2-yl)phenyl]phenoxy]propyl]piperidin-4-ol (PubChem CID 155670313) has the molecular formula C28H35N3O2S and a molecular weight of 477.67 g/mol. Its IUPAC name is 3-[3-[2-methyl-3-[2-methyl-3-(4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridin-2-yl)phenyl]phenoxy]propyl]piperidin-4-ol.
| Compound Name | 3-[3-[2-methyl-3-[2-methyl-3-(4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridin-2-yl)phenyl]phenoxy]propyl]piperidin-4-ol |
|---|---|
| PubChem CID | 155670313 |
| Molecular Formula | C28H35N3O2S |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 3-[3-[2-methyl-3-[2-methyl-3-(4,5,6,7-tetrahydro-[1,3]thiazolo[4,5-c]pyridin-2-yl)phenyl]phenoxy]propyl]piperidin-4-ol |
| SMILES | Cc1c(OCCCC2CNCCC2O)cccc1-c1cccc(-c2nc3c(s2)CCNC3)c1C |
| InChI | InChI=1S/C28H35N3O2S/c1-18-21(7-3-9-23(18)28-31-24-17-30-14-12-27(24)34-28)22-8-4-10-26(19(22)2)33-15-5-6-20-16-29-13-11-25(20)32/h3-4,7-10,20,25,29-30,32H,5-6,11-17H2,1-2H3 |
| InChIKey | XFVIIVASMPOJHX-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|