C52H81NS2Sn2 — CID 155671046
tributyl-[5-[9-octyl-7-(5-tributylstannylthiophen-2-yl)carbazol-2-yl]thiophen-2-yl]stannane (PubChem CID 155671046) has the molecular formula C52H81NS2Sn2 and a molecular weight of 1021.78 g/mol. Its IUPAC name is tributyl-[5-[9-octyl-7-(5-tributylstannylthiophen-2-yl)carbazol-2-yl]thiophen-2-yl]stannane.
| Compound Name | tributyl-[5-[9-octyl-7-(5-tributylstannylthiophen-2-yl)carbazol-2-yl]thiophen-2-yl]stannane |
|---|---|
| PubChem CID | 155671046 |
| Molecular Formula | C52H81NS2Sn2 |
| Molecular Weight | 1021.78 g/mol |
| Exact Mass | 1023.39 |
| IUPAC Name | tributyl-[5-[9-octyl-7-(5-tributylstannylthiophen-2-yl)carbazol-2-yl]thiophen-2-yl]stannane |
| SMILES | CCCCCCCCn1c2cc(-c3ccc([Sn](CCCC)(CCCC)CCCC)s3)ccc2c2ccc(-c3ccc([Sn](CCCC)(CCCC)CCCC)s3)cc21 |
| InChI | InChI=1S/C28H27NS2.6C4H9.2Sn/c1-2-3-4-5-6-7-16-29-25-19-21(27-10-8-17-30-27)12-14-23(25)24-15-13-22(20-26(24)29)28-11-9-18-31-28;6*1-3-4-2;;/h8-15,19-20H,2-7,16H2,1H3;6*1,3-4H2,2H3;; |
| InChIKey | BRHQEZDZKQIQKT-UHFFFAOYSA-N |
| XLogP | 17.72 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1021.78 |
| LogP ≤ 5 | 17.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|