C19H27N3O3S — CID 155672761
tert-butyl 3-(4-methoxyphenyl)-2-sulfanyl-1,4,8-triazaspiro[4.5]dec-3-ene-8-carboxylate (PubChem CID 155672761) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is tert-butyl 3-(4-methoxyphenyl)-2-sulfanyl-1,4,8-triazaspiro[4.5]dec-3-ene-8-carboxylate.
| Compound Name | tert-butyl 3-(4-methoxyphenyl)-2-sulfanyl-1,4,8-triazaspiro[4.5]dec-3-ene-8-carboxylate |
|---|---|
| PubChem CID | 155672761 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | tert-butyl 3-(4-methoxyphenyl)-2-sulfanyl-1,4,8-triazaspiro[4.5]dec-3-ene-8-carboxylate |
| SMILES | COc1ccc(C2=NC3(CCN(C(=O)OC(C)(C)C)CC3)NC2S)cc1 |
| InChI | InChI=1S/C19H27N3O3S/c1-18(2,3)25-17(23)22-11-9-19(10-12-22)20-15(16(26)21-19)13-5-7-14(24-4)8-6-13/h5-8,16,21,26H,9-12H2,1-4H3 |
| InChIKey | CSQWCBQUCHERMB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|