C18H21Cl2N3O2S — CID 139434847
tert-butyl 3-(3,4-dichlorophenyl)-2-sulfanylidene-1,4,8-triazaspiro[4.5]dec-3-ene-8-carboxylate (PubChem CID 139434847) has the molecular formula C18H21Cl2N3O2S and a molecular weight of 414.36 g/mol. Its IUPAC name is tert-butyl 3-(3,4-dichlorophenyl)-2-sulfanylidene-1,4,8-triazaspiro[4.5]dec-3-ene-8-carboxylate.
| Compound Name | tert-butyl 3-(3,4-dichlorophenyl)-2-sulfanylidene-1,4,8-triazaspiro[4.5]dec-3-ene-8-carboxylate |
|---|---|
| PubChem CID | 139434847 |
| Molecular Formula | C18H21Cl2N3O2S |
| Molecular Weight | 414.36 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | tert-butyl 3-(3,4-dichlorophenyl)-2-sulfanylidene-1,4,8-triazaspiro[4.5]dec-3-ene-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)N=C(c1ccc(Cl)c(Cl)c1)C(=S)N2 |
| InChI | InChI=1S/C18H21Cl2N3O2S/c1-17(2,3)25-16(24)23-8-6-18(7-9-23)21-14(15(26)22-18)11-4-5-12(19)13(20)10-11/h4-5,10H,6-9H2,1-3H3,(H,22,26) |
| InChIKey | LBCUVLCBMHRXHQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.36 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|