C10H13N3O — CID 155673544
1-(3-amino-5,6,7,8-tetrahydroquinoxalin-2-yl)ethanone (PubChem CID 155673544) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 1-(3-amino-5,6,7,8-tetrahydroquinoxalin-2-yl)ethanone.
| Compound Name | 1-(3-amino-5,6,7,8-tetrahydroquinoxalin-2-yl)ethanone |
|---|---|
| PubChem CID | 155673544 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 1-(3-amino-5,6,7,8-tetrahydroquinoxalin-2-yl)ethanone |
| SMILES | CC(=O)c1nc2c(nc1N)CCCC2 |
| InChI | InChI=1S/C10H13N3O/c1-6(14)9-10(11)13-8-5-3-2-4-7(8)12-9/h2-5H2,1H3,(H2,11,13) |
| InChIKey | YDIQLVCKRJMNOX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |