C21H15F2N3O2 — CID 155673807
1-[3-[(4-cyanophenoxy)methyl]phenyl]-3-(3,5-difluorophenyl)urea (PubChem CID 155673807) has the molecular formula C21H15F2N3O2 and a molecular weight of 379.37 g/mol. Its IUPAC name is 1-[3-[(4-cyanophenoxy)methyl]phenyl]-3-(3,5-difluorophenyl)urea.
| Compound Name | 1-[3-[(4-cyanophenoxy)methyl]phenyl]-3-(3,5-difluorophenyl)urea |
|---|---|
| PubChem CID | 155673807 |
| Molecular Formula | C21H15F2N3O2 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 1-[3-[(4-cyanophenoxy)methyl]phenyl]-3-(3,5-difluorophenyl)urea |
| SMILES | N#Cc1ccc(OCc2cccc(NC(=O)Nc3cc(F)cc(F)c3)c2)cc1 |
| InChI | InChI=1S/C21H15F2N3O2/c22-16-9-17(23)11-19(10-16)26-21(27)25-18-3-1-2-15(8-18)13-28-20-6-4-14(12-24)5-7-20/h1-11H,13H2,(H2,25,26,27) |
| InChIKey | GFQBUQCZLJYJKY-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |