C11H9ClN4 — CID 155675906
2-(2-chloropyrimidin-4-yl)-1,3-dihydroindazole (PubChem CID 155675906) has the molecular formula C11H9ClN4 and a molecular weight of 232.67 g/mol. Its IUPAC name is 2-(2-chloropyrimidin-4-yl)-1,3-dihydroindazole.
| Compound Name | 2-(2-chloropyrimidin-4-yl)-1,3-dihydroindazole |
|---|---|
| PubChem CID | 155675906 |
| Molecular Formula | C11H9ClN4 |
| Molecular Weight | 232.67 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 2-(2-chloropyrimidin-4-yl)-1,3-dihydroindazole |
| SMILES | Clc1nccc(N2Cc3ccccc3N2)n1 |
| InChI | InChI=1S/C11H9ClN4/c12-11-13-6-5-10(14-11)16-7-8-3-1-2-4-9(8)15-16/h1-6,15H,7H2 |
| InChIKey | YKZOGJJINRONHV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.67 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |