C17H19BrO3S — CID 155676025
methyl 4-[3-(1-bromopropyl)-6-methyl-1-benzothiophen-2-yl]-4-oxobutanoate (PubChem CID 155676025) has the molecular formula C17H19BrO3S and a molecular weight of 383.31 g/mol. Its IUPAC name is methyl 4-[3-(1-bromopropyl)-6-methyl-1-benzothiophen-2-yl]-4-oxobutanoate.
| Compound Name | methyl 4-[3-(1-bromopropyl)-6-methyl-1-benzothiophen-2-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 155676025 |
| Molecular Formula | C17H19BrO3S |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | methyl 4-[3-(1-bromopropyl)-6-methyl-1-benzothiophen-2-yl]-4-oxobutanoate |
| SMILES | CCC(Br)c1c(C(=O)CCC(=O)OC)sc2cc(C)ccc12 |
| InChI | InChI=1S/C17H19BrO3S/c1-4-12(18)16-11-6-5-10(2)9-14(11)22-17(16)13(19)7-8-15(20)21-3/h5-6,9,12H,4,7-8H2,1-3H3 |
| InChIKey | VDQGKCDWLKKLTI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|