C18H23NO6S — CID 166928750
methyl 4-[3-(3-aminopropoxy)-5,6-dimethoxy-1-benzothiophen-2-yl]-4-oxobutanoate (PubChem CID 166928750) has the molecular formula C18H23NO6S and a molecular weight of 381.45 g/mol. Its IUPAC name is methyl 4-[3-(3-aminopropoxy)-5,6-dimethoxy-1-benzothiophen-2-yl]-4-oxobutanoate.
| Compound Name | methyl 4-[3-(3-aminopropoxy)-5,6-dimethoxy-1-benzothiophen-2-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 166928750 |
| Molecular Formula | C18H23NO6S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | methyl 4-[3-(3-aminopropoxy)-5,6-dimethoxy-1-benzothiophen-2-yl]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)c1sc2cc(OC)c(OC)cc2c1OCCCN |
| InChI | InChI=1S/C18H23NO6S/c1-22-13-9-11-15(10-14(13)23-2)26-18(17(11)25-8-4-7-19)12(20)5-6-16(21)24-3/h9-10H,4-8,19H2,1-3H3 |
| InChIKey | MKNLETGKAXKPCZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|