C17H20O4S — CID 155676029
methyl 4-[3-(1-hydroxypropyl)-6-methyl-1-benzothiophen-2-yl]-4-oxobutanoate (PubChem CID 155676029) has the molecular formula C17H20O4S and a molecular weight of 320.41 g/mol. Its IUPAC name is methyl 4-[3-(1-hydroxypropyl)-6-methyl-1-benzothiophen-2-yl]-4-oxobutanoate.
| Compound Name | methyl 4-[3-(1-hydroxypropyl)-6-methyl-1-benzothiophen-2-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 155676029 |
| Molecular Formula | C17H20O4S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | methyl 4-[3-(1-hydroxypropyl)-6-methyl-1-benzothiophen-2-yl]-4-oxobutanoate |
| SMILES | CCC(O)c1c(C(=O)CCC(=O)OC)sc2cc(C)ccc12 |
| InChI | InChI=1S/C17H20O4S/c1-4-12(18)16-11-6-5-10(2)9-14(11)22-17(16)13(19)7-8-15(20)21-3/h5-6,9,12,18H,4,7-8H2,1-3H3 |
| InChIKey | XADGWMTXARAJPD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |