C24H24ClF3N4O4 — CID 155680803
6-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]-N-(1,3-dihydroxypropan-2-yl)-6,7,8,9-tetrahydro-5H-carbazole-2-carboxamide (PubChem CID 155680803) has the molecular formula C24H24ClF3N4O4 and a molecular weight of 524.93 g/mol. Its IUPAC name is 6-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]-N-(1,3-dihydroxypropan-2-yl)-6,7,8,9-tetrahydro-5H-carbazole-2-carboxamide.
| Compound Name | 6-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]-N-(1,3-dihydroxypropan-2-yl)-6,7,8,9-tetrahydro-5H-carbazole-2-carboxamide |
|---|---|
| PubChem CID | 155680803 |
| Molecular Formula | C24H24ClF3N4O4 |
| Molecular Weight | 524.93 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | 6-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]-N-(1,3-dihydroxypropan-2-yl)-6,7,8,9-tetrahydro-5H-carbazole-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)NC1CCc2[nH]c3cc(C(=O)NC(CO)CO)ccc3c2C1 |
| InChI | InChI=1S/C24H24ClF3N4O4/c25-19-5-2-14(9-18(19)24(26,27)28)31-23(36)30-13-3-6-20-17(8-13)16-4-1-12(7-21(16)32-20)22(35)29-15(10-33)11-34/h1-2,4-5,7,9,13,15,32-34H,3,6,8,10-11H2,(H,29,35)(H2,30,31,36) |
| InChIKey | WRUAIASMJFCWSL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.93 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|