C21H19ClF3N3O5 — CID 90084993
[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]cyclohexyl] 4-nitrobenzoate (PubChem CID 90084993) has the molecular formula C21H19ClF3N3O5 and a molecular weight of 485.85 g/mol. Its IUPAC name is [4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]cyclohexyl] 4-nitrobenzoate.
| Compound Name | [4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]cyclohexyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 90084993 |
| Molecular Formula | C21H19ClF3N3O5 |
| Molecular Weight | 485.85 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | [4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]cyclohexyl] 4-nitrobenzoate |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)NC1CCC(OC(=O)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C21H19ClF3N3O5/c22-18-10-5-14(11-17(18)21(23,24)25)27-20(30)26-13-3-8-16(9-4-13)33-19(29)12-1-6-15(7-2-12)28(31)32/h1-2,5-7,10-11,13,16H,3-4,8-9H2,(H2,26,27,30) |
| InChIKey | KNOFLPGANULZOF-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.85 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|