C23H20N4O — CID 155683412
(E)-3-naphthalen-1-yl-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]prop-2-enamide (PubChem CID 155683412) has the molecular formula C23H20N4O and a molecular weight of 368.44 g/mol. Its IUPAC name is (E)-3-naphthalen-1-yl-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-naphthalen-1-yl-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 155683412 |
| Molecular Formula | C23H20N4O |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | (E)-3-naphthalen-1-yl-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc2ccccc12)NC(Cn1cncn1)c1ccccc1 |
| InChI | InChI=1S/C23H20N4O/c28-23(14-13-19-11-6-10-18-7-4-5-12-21(18)19)26-22(15-27-17-24-16-25-27)20-8-2-1-3-9-20/h1-14,16-17,22H,15H2,(H,26,28)/b14-13+ |
| InChIKey | FHECMRUBZFXERM-BUHFOSPRSA-N |
| XLogP | 4.00 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|