6-hydroxy-3,4,5-trimethylnaphthalene-2-carboxylic acid

C14H14O3 — CID 155685907

IUPAC6-hydroxy-3,4,5-trimethylnaphthalene-2-carboxylic acid
SMILESCc1c(C(=O)O)cc2ccc(O)c(C)c2c1C
InChIInChI=1S/C14H14O3/c1-7-8(2)13-9(3)12(15)5-4-10(13)6-11(7)14(16)17/h4-6,15H,1-3H3,(H,16,17)
InChIKeyOOLQIWVOOLNUFC-UHFFFAOYSA-N
MW230.26 g/mol
LogP3.17
Rot. Bonds1

About 6-hydroxy-3,4,5-trimethylnaphthalene-2-carboxylic acid

6-hydroxy-3,4,5-trimethylnaphthalene-2-carboxylic acid (PubChem CID 155685907) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is 6-hydroxy-3,4,5-trimethylnaphthalene-2-carboxylic acid.

Molecular Properties

Compound Name6-hydroxy-3,4,5-trimethylnaphthalene-2-carboxylic acid
PubChem CID155685907
Molecular FormulaC14H14O3
Molecular Weight230.26 g/mol
Exact Mass230.09
IUPAC Name6-hydroxy-3,4,5-trimethylnaphthalene-2-carboxylic acid
SMILESCc1c(C(=O)O)cc2ccc(O)c(C)c2c1C
InChIInChI=1S/C14H14O3/c1-7-8(2)13-9(3)12(15)5-4-10(13)6-11(7)14(16)17/h4-6,15H,1-3H3,(H,16,17)
InChIKeyOOLQIWVOOLNUFC-UHFFFAOYSA-N
XLogP3.17
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.26
LogP ≤ 53.17
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 6-hydroxy-3,4,5-trimethylnaphthalene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-hydroxy-3,4,5-trimethylnaphthalene-2-carboxylic acid?
The IUPAC name of 6-hydroxy-3,4,5-trimethylnaphthalene-2-carboxylic acid (CID 155685907) is 6-hydroxy-3,4,5-trimethylnaphthalene-2-carboxylic acid.
What is the SMILES notation for 6-hydroxy-3,4,5-trimethylnaphthalene-2-carboxylic acid?
The canonical SMILES for 6-hydroxy-3,4,5-trimethylnaphthalene-2-carboxylic acid is Cc1c(C(=O)O)cc2ccc(O)c(C)c2c1C.
What is the InChIKey of 6-hydroxy-3,4,5-trimethylnaphthalene-2-carboxylic acid?
The InChIKey is OOLQIWVOOLNUFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O3/c1-7-8(2)13-9(3)12(15)5-4-10(13)6-11(7)14(16)17/h4-6,15H,1-3H3,(H,16,17).
What are the key properties of 6-hydroxy-3,4,5-trimethylnaphthalene-2-carboxylic acid?
6-hydroxy-3,4,5-trimethylnaphthalene-2-carboxylic acid has a molecular weight of 230.26 g/mol, XLogP of 3.17, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-3,4,5-trimethylnaphthalene-2-carboxylic acid is sourced from PubChem (CID 155685907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).