C15H16O3 — CID 155685922
6-hydroxy-3,4,5,7-tetramethylnaphthalene-2-carboxylic acid (PubChem CID 155685922) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is 6-hydroxy-3,4,5,7-tetramethylnaphthalene-2-carboxylic acid.
| Compound Name | 6-hydroxy-3,4,5,7-tetramethylnaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 155685922 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 6-hydroxy-3,4,5,7-tetramethylnaphthalene-2-carboxylic acid |
| SMILES | Cc1cc2cc(C(=O)O)c(C)c(C)c2c(C)c1O |
| InChI | InChI=1S/C15H16O3/c1-7-5-11-6-12(15(17)18)8(2)9(3)13(11)10(4)14(7)16/h5-6,16H,1-4H3,(H,17,18) |
| InChIKey | UEXXBZXXHLQUNI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |