6-hydroxy-4,7-dimethylnaphthalene-2-carboxylic acid

C13H12O3 — CID 155685951

IUPAC6-hydroxy-4,7-dimethylnaphthalene-2-carboxylic acid
SMILESCc1cc2cc(C(=O)O)cc(C)c2cc1O
InChIInChI=1S/C13H12O3/c1-7-3-10(13(15)16)5-9-4-8(2)12(14)6-11(7)9/h3-6,14H,1-2H3,(H,15,16)
InChIKeyOPKWEJRQLOWJFI-UHFFFAOYSA-N
MW216.24 g/mol
LogP2.86
Rot. Bonds1

About 6-hydroxy-4,7-dimethylnaphthalene-2-carboxylic acid

6-hydroxy-4,7-dimethylnaphthalene-2-carboxylic acid (PubChem CID 155685951) has the molecular formula C13H12O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is 6-hydroxy-4,7-dimethylnaphthalene-2-carboxylic acid.

Molecular Properties

Compound Name6-hydroxy-4,7-dimethylnaphthalene-2-carboxylic acid
PubChem CID155685951
Molecular FormulaC13H12O3
Molecular Weight216.24 g/mol
Exact Mass216.08
IUPAC Name6-hydroxy-4,7-dimethylnaphthalene-2-carboxylic acid
SMILESCc1cc2cc(C(=O)O)cc(C)c2cc1O
InChIInChI=1S/C13H12O3/c1-7-3-10(13(15)16)5-9-4-8(2)12(14)6-11(7)9/h3-6,14H,1-2H3,(H,15,16)
InChIKeyOPKWEJRQLOWJFI-UHFFFAOYSA-N
XLogP2.86
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.24
LogP ≤ 52.86
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 6-hydroxy-4,7-dimethylnaphthalene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-hydroxy-4,7-dimethylnaphthalene-2-carboxylic acid?
The IUPAC name of 6-hydroxy-4,7-dimethylnaphthalene-2-carboxylic acid (CID 155685951) is 6-hydroxy-4,7-dimethylnaphthalene-2-carboxylic acid.
What is the SMILES notation for 6-hydroxy-4,7-dimethylnaphthalene-2-carboxylic acid?
The canonical SMILES for 6-hydroxy-4,7-dimethylnaphthalene-2-carboxylic acid is Cc1cc2cc(C(=O)O)cc(C)c2cc1O.
What is the InChIKey of 6-hydroxy-4,7-dimethylnaphthalene-2-carboxylic acid?
The InChIKey is OPKWEJRQLOWJFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O3/c1-7-3-10(13(15)16)5-9-4-8(2)12(14)6-11(7)9/h3-6,14H,1-2H3,(H,15,16).
What are the key properties of 6-hydroxy-4,7-dimethylnaphthalene-2-carboxylic acid?
6-hydroxy-4,7-dimethylnaphthalene-2-carboxylic acid has a molecular weight of 216.24 g/mol, XLogP of 2.86, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-4,7-dimethylnaphthalene-2-carboxylic acid is sourced from PubChem (CID 155685951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).