C20H32N2O2S — CID 155690187
3-[[2-[tert-butyl(dimethyl)-λ4-sulfanyl]oxyethylamino]methyl]-6,8-dimethyl-1H-quinolin-2-one (PubChem CID 155690187) has the molecular formula C20H32N2O2S and a molecular weight of 364.56 g/mol. Its IUPAC name is 3-[[2-[tert-butyl(dimethyl)-λ4-sulfanyl]oxyethylamino]methyl]-6,8-dimethyl-1H-quinolin-2-one.
| Compound Name | 3-[[2-[tert-butyl(dimethyl)-λ4-sulfanyl]oxyethylamino]methyl]-6,8-dimethyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 155690187 |
| Molecular Formula | C20H32N2O2S |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 3-[[2-[tert-butyl(dimethyl)-λ4-sulfanyl]oxyethylamino]methyl]-6,8-dimethyl-1H-quinolin-2-one |
| SMILES | Cc1cc(C)c2[nH]c(=O)c(CNCCOS(C)(C)C(C)(C)C)cc2c1 |
| InChI | InChI=1S/C20H32N2O2S/c1-14-10-15(2)18-16(11-14)12-17(19(23)22-18)13-21-8-9-24-25(6,7)20(3,4)5/h10-12,21H,8-9,13H2,1-7H3,(H,22,23) |
| InChIKey | FVIKGZAGSUUSEJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|