C25H46N3+ — CID 155691977
ethane;propane;(Z)-N-[(2E,6Z,8Z)-3,13,13-trimethyl-10-methylidene-1-aza-13-azoniabicyclo[9.4.0]pentadeca-2,6,8-trien-2-yl]propan-1-imine (PubChem CID 155691977) has the molecular formula C25H46N3+ and a molecular weight of 388.66 g/mol. Its IUPAC name is ethane;propane;(Z)-N-[(2E,6Z,8Z)-3,13,13-trimethyl-10-methylidene-1-aza-13-azoniabicyclo[9.4.0]pentadeca-2,6,8-trien-2-yl]propan-1-imine.
| Compound Name | ethane;propane;(Z)-N-[(2E,6Z,8Z)-3,13,13-trimethyl-10-methylidene-1-aza-13-azoniabicyclo[9.4.0]pentadeca-2,6,8-trien-2-yl]propan-1-imine |
|---|---|
| PubChem CID | 155691977 |
| Molecular Formula | C25H46N3+ |
| Molecular Weight | 388.66 g/mol |
| Exact Mass | 388.37 |
| IUPAC Name | ethane;propane;(Z)-N-[(2E,6Z,8Z)-3,13,13-trimethyl-10-methylidene-1-aza-13-azoniabicyclo[9.4.0]pentadeca-2,6,8-trien-2-yl]propan-1-imine |
| SMILES | C=C1/C=C\C=C/CC/C(C)=C(/N=C\CC)N2CC[N+](C)(C)CC12.CC.CCC |
| InChI | InChI=1S/C20H32N3.C3H8.C2H6/c1-6-13-21-20-18(3)12-10-8-7-9-11-17(2)19-16-23(4,5)15-14-22(19)20;1-3-2;1-2/h7-9,11,13,19H,2,6,10,12,14-16H2,1,3-5H3;3H2,1-2H3;1-2H3/q+1;;/b8-7-,11-9-,20-18-,21-13-;; |
| InChIKey | ACSKVCYZRUSRNI-MNQXZKERSA-N |
| XLogP | 6.36 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.66 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|