C20H32N3+ — CID 155691978
(Z)-N-[(2E,6Z,8Z)-3,13,13-trimethyl-10-methylidene-1-aza-13-azoniabicyclo[9.4.0]pentadeca-2,6,8-trien-2-yl]propan-1-imine (PubChem CID 155691978) has the molecular formula C20H32N3+ and a molecular weight of 314.50 g/mol. Its IUPAC name is (Z)-N-[(2E,6Z,8Z)-3,13,13-trimethyl-10-methylidene-1-aza-13-azoniabicyclo[9.4.0]pentadeca-2,6,8-trien-2-yl]propan-1-imine.
| Compound Name | (Z)-N-[(2E,6Z,8Z)-3,13,13-trimethyl-10-methylidene-1-aza-13-azoniabicyclo[9.4.0]pentadeca-2,6,8-trien-2-yl]propan-1-imine |
|---|---|
| PubChem CID | 155691978 |
| Molecular Formula | C20H32N3+ |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | (Z)-N-[(2E,6Z,8Z)-3,13,13-trimethyl-10-methylidene-1-aza-13-azoniabicyclo[9.4.0]pentadeca-2,6,8-trien-2-yl]propan-1-imine |
| SMILES | C=C1/C=C\C=C/CC/C(C)=C(/N=C\CC)N2CC[N+](C)(C)CC12 |
| InChI | InChI=1S/C20H32N3/c1-6-13-21-20-18(3)12-10-8-7-9-11-17(2)19-16-23(4,5)15-14-22(19)20/h7-9,11,13,19H,2,6,10,12,14-16H2,1,3-5H3/q+1/b8-7-,11-9-,20-18-,21-13- |
| InChIKey | SZBIUMCENGARRL-UGDYDMLVSA-N |
| XLogP | 3.92 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|