C16H27N3 — CID 156866807
3-ethyl-7-[(3R,5S)-4-ethyl-3,5-dimethylpiperazin-1-yl]-3H-azepine (PubChem CID 156866807) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is 3-ethyl-7-[(3R,5S)-4-ethyl-3,5-dimethylpiperazin-1-yl]-3H-azepine.
| Compound Name | 3-ethyl-7-[(3R,5S)-4-ethyl-3,5-dimethylpiperazin-1-yl]-3H-azepine |
|---|---|
| PubChem CID | 156866807 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | 3-ethyl-7-[(3R,5S)-4-ethyl-3,5-dimethylpiperazin-1-yl]-3H-azepine |
| SMILES | CCC1C=CC=C(N2C[C@@H](C)N(CC)[C@@H](C)C2)N=C1 |
| InChI | InChI=1S/C16H27N3/c1-5-15-8-7-9-16(17-10-15)18-11-13(3)19(6-2)14(4)12-18/h7-10,13-15H,5-6,11-12H2,1-4H3/t13-,14+,15? |
| InChIKey | YGHJBKWDCSLKGP-YIONKMFJSA-N |
| XLogP | 2.91 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |