C22H28N2OS — CID 155692023
1-[1-benzyl-8-(methylsulfanylamino)-3,4-dihydro-2H-quinolin-6-yl]pentan-1-one (PubChem CID 155692023) has the molecular formula C22H28N2OS and a molecular weight of 368.55 g/mol. Its IUPAC name is 1-[1-benzyl-8-(methylsulfanylamino)-3,4-dihydro-2H-quinolin-6-yl]pentan-1-one.
| Compound Name | 1-[1-benzyl-8-(methylsulfanylamino)-3,4-dihydro-2H-quinolin-6-yl]pentan-1-one |
|---|---|
| PubChem CID | 155692023 |
| Molecular Formula | C22H28N2OS |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 1-[1-benzyl-8-(methylsulfanylamino)-3,4-dihydro-2H-quinolin-6-yl]pentan-1-one |
| SMILES | CCCCC(=O)c1cc2c(c(NSC)c1)N(Cc1ccccc1)CCC2 |
| InChI | InChI=1S/C22H28N2OS/c1-3-4-12-21(25)19-14-18-11-8-13-24(16-17-9-6-5-7-10-17)22(18)20(15-19)23-26-2/h5-7,9-10,14-15,23H,3-4,8,11-13,16H2,1-2H3 |
| InChIKey | ACQOMJKCPSANRK-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|