C26H37NO — CID 155692236
N-(2,6-dimethylphenyl)-4,4-diethyl-8-phenyloctanamide (PubChem CID 155692236) has the molecular formula C26H37NO and a molecular weight of 379.59 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-4,4-diethyl-8-phenyloctanamide.
| Compound Name | N-(2,6-dimethylphenyl)-4,4-diethyl-8-phenyloctanamide |
|---|---|
| PubChem CID | 155692236 |
| Molecular Formula | C26H37NO |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.29 |
| IUPAC Name | N-(2,6-dimethylphenyl)-4,4-diethyl-8-phenyloctanamide |
| SMILES | CCC(CC)(CCCCc1ccccc1)CCC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C26H37NO/c1-5-26(6-2,19-11-10-17-23-15-8-7-9-16-23)20-18-24(28)27-25-21(3)13-12-14-22(25)4/h7-9,12-16H,5-6,10-11,17-20H2,1-4H3,(H,27,28) |
| InChIKey | QEFLRKVILOGFII-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|