C15H23N2O+ — CID 155692435
[1-(2,6-dimethylphenyl)-2-oxopyrrolidin-3-yl]-trimethylazanium (PubChem CID 155692435) has the molecular formula C15H23N2O+ and a molecular weight of 247.36 g/mol. Its IUPAC name is [1-(2,6-dimethylphenyl)-2-oxopyrrolidin-3-yl]-trimethylazanium.
| Compound Name | [1-(2,6-dimethylphenyl)-2-oxopyrrolidin-3-yl]-trimethylazanium |
|---|---|
| PubChem CID | 155692435 |
| Molecular Formula | C15H23N2O+ |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | [1-(2,6-dimethylphenyl)-2-oxopyrrolidin-3-yl]-trimethylazanium |
| SMILES | Cc1cccc(C)c1N1CCC([N+](C)(C)C)C1=O |
| InChI | InChI=1S/C15H23N2O/c1-11-7-6-8-12(2)14(11)16-10-9-13(15(16)18)17(3,4)5/h6-8,13H,9-10H2,1-5H3/q+1 |
| InChIKey | BFXLMDRPJVNWQI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|