C19H29N2OY+ — CID 158665564
1-(2,6-dimethylphenyl)-3-(1-ethylpyrrolidin-1-ium-1-yl)piperidin-2-one;yttrium (PubChem CID 158665564) has the molecular formula C19H29N2OY+ and a molecular weight of 390.36 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-(1-ethylpyrrolidin-1-ium-1-yl)piperidin-2-one;yttrium.
| Compound Name | 1-(2,6-dimethylphenyl)-3-(1-ethylpyrrolidin-1-ium-1-yl)piperidin-2-one;yttrium |
|---|---|
| PubChem CID | 158665564 |
| Molecular Formula | C19H29N2OY+ |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-(1-ethylpyrrolidin-1-ium-1-yl)piperidin-2-one;yttrium |
| SMILES | CC[N+]1(C2CCCN(c3c(C)cccc3C)C2=O)CCCC1.[Y] |
| InChI | InChI=1S/C19H29N2O.Y/c1-4-21(13-5-6-14-21)17-11-8-12-20(19(17)22)18-15(2)9-7-10-16(18)3;/h7,9-10,17H,4-6,8,11-14H2,1-3H3;/q+1; |
| InChIKey | ZJPYHFBMWROFHA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|