C26H37N2O2Y+ — CID 159339511
3-(1-ethylpyrrolidin-1-ium-1-yl)-1-(4-methoxy-2,6-dimethylphenyl)pyrrolidin-2-one;toluene;yttrium (PubChem CID 159339511) has the molecular formula C26H37N2O2Y+ and a molecular weight of 498.50 g/mol. Its IUPAC name is 3-(1-ethylpyrrolidin-1-ium-1-yl)-1-(4-methoxy-2,6-dimethylphenyl)pyrrolidin-2-one;toluene;yttrium.
| Compound Name | 3-(1-ethylpyrrolidin-1-ium-1-yl)-1-(4-methoxy-2,6-dimethylphenyl)pyrrolidin-2-one;toluene;yttrium |
|---|---|
| PubChem CID | 159339511 |
| Molecular Formula | C26H37N2O2Y+ |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 3-(1-ethylpyrrolidin-1-ium-1-yl)-1-(4-methoxy-2,6-dimethylphenyl)pyrrolidin-2-one;toluene;yttrium |
| SMILES | CC[N+]1(C2CCN(c3c(C)cc(OC)cc3C)C2=O)CCCC1.Cc1ccccc1.[Y] |
| InChI | InChI=1S/C19H29N2O2.C7H8.Y/c1-5-21(10-6-7-11-21)17-8-9-20(19(17)22)18-14(2)12-16(23-4)13-15(18)3;1-7-5-3-2-4-6-7;/h12-13,17H,5-11H2,1-4H3;2-6H,1H3;/q+1;; |
| InChIKey | LDWLSSQAOHVIII-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|