C22H39N2O2+ — CID 155693222
ethane;ethyl-[1-(4-methoxy-2,6-dimethylphenyl)-2-oxopiperidin-3-yl]-methyl-propylazanium (PubChem CID 155693222) has the molecular formula C22H39N2O2+ and a molecular weight of 363.57 g/mol. Its IUPAC name is ethane;ethyl-[1-(4-methoxy-2,6-dimethylphenyl)-2-oxopiperidin-3-yl]-methyl-propylazanium.
| Compound Name | ethane;ethyl-[1-(4-methoxy-2,6-dimethylphenyl)-2-oxopiperidin-3-yl]-methyl-propylazanium |
|---|---|
| PubChem CID | 155693222 |
| Molecular Formula | C22H39N2O2+ |
| Molecular Weight | 363.57 g/mol |
| Exact Mass | 363.30 |
| IUPAC Name | ethane;ethyl-[1-(4-methoxy-2,6-dimethylphenyl)-2-oxopiperidin-3-yl]-methyl-propylazanium |
| SMILES | CC.CCC[N+](C)(CC)C1CCCN(c2c(C)cc(OC)cc2C)C1=O |
| InChI | InChI=1S/C20H33N2O2.C2H6/c1-7-12-22(5,8-2)18-10-9-11-21(20(18)23)19-15(3)13-17(24-6)14-16(19)4;1-2/h13-14,18H,7-12H2,1-6H3;1-2H3/q+1; |
| InChIKey | NDBUPYQKLSMNER-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|