C20H30ClN2O+ — CID 158950032
1-(4-chloro-2,6-dimethylphenyl)-3-(1-ethylpiperidin-1-ium-1-yl)piperidin-2-one (PubChem CID 158950032) has the molecular formula C20H30ClN2O+ and a molecular weight of 349.93 g/mol. Its IUPAC name is 1-(4-chloro-2,6-dimethylphenyl)-3-(1-ethylpiperidin-1-ium-1-yl)piperidin-2-one.
| Compound Name | 1-(4-chloro-2,6-dimethylphenyl)-3-(1-ethylpiperidin-1-ium-1-yl)piperidin-2-one |
|---|---|
| PubChem CID | 158950032 |
| Molecular Formula | C20H30ClN2O+ |
| Molecular Weight | 349.93 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 1-(4-chloro-2,6-dimethylphenyl)-3-(1-ethylpiperidin-1-ium-1-yl)piperidin-2-one |
| SMILES | CC[N+]1(C2CCCN(c3c(C)cc(Cl)cc3C)C2=O)CCCCC1 |
| InChI | InChI=1S/C20H30ClN2O/c1-4-23(11-6-5-7-12-23)18-9-8-10-22(20(18)24)19-15(2)13-17(21)14-16(19)3/h13-14,18H,4-12H2,1-3H3/q+1 |
| InChIKey | YUTYFXZQJJJFSK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.93 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|