C21H35N2O+ — CID 155693323
butyl-ethyl-methyl-[2-oxo-1-(2,4,6-trimethylphenyl)piperidin-3-yl]azanium (PubChem CID 155693323) has the molecular formula C21H35N2O+ and a molecular weight of 331.52 g/mol. Its IUPAC name is butyl-ethyl-methyl-[2-oxo-1-(2,4,6-trimethylphenyl)piperidin-3-yl]azanium.
| Compound Name | butyl-ethyl-methyl-[2-oxo-1-(2,4,6-trimethylphenyl)piperidin-3-yl]azanium |
|---|---|
| PubChem CID | 155693323 |
| Molecular Formula | C21H35N2O+ |
| Molecular Weight | 331.52 g/mol |
| Exact Mass | 331.27 |
| IUPAC Name | butyl-ethyl-methyl-[2-oxo-1-(2,4,6-trimethylphenyl)piperidin-3-yl]azanium |
| SMILES | CCCC[N+](C)(CC)C1CCCN(c2c(C)cc(C)cc2C)C1=O |
| InChI | InChI=1S/C21H35N2O/c1-7-9-13-23(6,8-2)19-11-10-12-22(21(19)24)20-17(4)14-16(3)15-18(20)5/h14-15,19H,7-13H2,1-6H3/q+1 |
| InChIKey | XJHVYSXJKYETEB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|