C17H26FN2OY+ — CID 158394261
ethyl-[1-(4-fluoro-2,6-dimethylphenyl)-2-oxopiperidin-3-yl]-dimethylazanium;yttrium (PubChem CID 158394261) has the molecular formula C17H26FN2OY+ and a molecular weight of 382.31 g/mol. Its IUPAC name is ethyl-[1-(4-fluoro-2,6-dimethylphenyl)-2-oxopiperidin-3-yl]-dimethylazanium;yttrium.
| Compound Name | ethyl-[1-(4-fluoro-2,6-dimethylphenyl)-2-oxopiperidin-3-yl]-dimethylazanium;yttrium |
|---|---|
| PubChem CID | 158394261 |
| Molecular Formula | C17H26FN2OY+ |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | ethyl-[1-(4-fluoro-2,6-dimethylphenyl)-2-oxopiperidin-3-yl]-dimethylazanium;yttrium |
| SMILES | CC[N+](C)(C)C1CCCN(c2c(C)cc(F)cc2C)C1=O.[Y] |
| InChI | InChI=1S/C17H26FN2O.Y/c1-6-20(4,5)15-8-7-9-19(17(15)21)16-12(2)10-14(18)11-13(16)3;/h10-11,15H,6-9H2,1-5H3;/q+1; |
| InChIKey | UCPDTQDEEYTQIJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|