C19H26N3OY+ — CID 159328054
3-(1-ethylpyrrolidin-1-ium-1-yl)-1-(4-isocyano-2,6-dimethylphenyl)pyrrolidin-2-one;yttrium (PubChem CID 159328054) has the molecular formula C19H26N3OY+ and a molecular weight of 401.34 g/mol. Its IUPAC name is 3-(1-ethylpyrrolidin-1-ium-1-yl)-1-(4-isocyano-2,6-dimethylphenyl)pyrrolidin-2-one;yttrium.
| Compound Name | 3-(1-ethylpyrrolidin-1-ium-1-yl)-1-(4-isocyano-2,6-dimethylphenyl)pyrrolidin-2-one;yttrium |
|---|---|
| PubChem CID | 159328054 |
| Molecular Formula | C19H26N3OY+ |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 3-(1-ethylpyrrolidin-1-ium-1-yl)-1-(4-isocyano-2,6-dimethylphenyl)pyrrolidin-2-one;yttrium |
| SMILES | [C-]#[N+]c1cc(C)c(N2CCC([N+]3(CC)CCCC3)C2=O)c(C)c1.[Y] |
| InChI | InChI=1S/C19H26N3O.Y/c1-5-22(10-6-7-11-22)17-8-9-21(19(17)23)18-14(2)12-16(20-4)13-15(18)3;/h12-13,17H,5-11H2,1-3H3;/q+1; |
| InChIKey | ABJXQVUZGTYFHT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 24.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|