C28H37F3N2O3 — CID 159614103
3-(1-benzylazepan-1-ium-1-yl)-1-(2,6-dimethylphenyl)piperidin-2-one;oxido(2,2,2-trifluoroethyl)oxidanium (PubChem CID 159614103) has the molecular formula C28H37F3N2O3 and a molecular weight of 506.61 g/mol. Its IUPAC name is 3-(1-benzylazepan-1-ium-1-yl)-1-(2,6-dimethylphenyl)piperidin-2-one;oxido(2,2,2-trifluoroethyl)oxidanium.
| Compound Name | 3-(1-benzylazepan-1-ium-1-yl)-1-(2,6-dimethylphenyl)piperidin-2-one;oxido(2,2,2-trifluoroethyl)oxidanium |
|---|---|
| PubChem CID | 159614103 |
| Molecular Formula | C28H37F3N2O3 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | 3-(1-benzylazepan-1-ium-1-yl)-1-(2,6-dimethylphenyl)piperidin-2-one;oxido(2,2,2-trifluoroethyl)oxidanium |
| SMILES | Cc1cccc(C)c1N1CCCC([N+]2(Cc3ccccc3)CCCCCC2)C1=O.[O-][OH+][CH-]C(F)(F)F |
| InChI | InChI=1S/C26H35N2O.C2H2F3O2/c1-21-12-10-13-22(2)25(21)27-17-11-16-24(26(27)29)28(18-8-3-4-9-19-28)20-23-14-6-5-7-15-23;3-2(4,5)1-7-6/h5-7,10,12-15,24H,3-4,8-9,11,16-20H2,1-2H3;1,7H/q+1;-1 |
| InChIKey | RRPNJGGWNYNFAY-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 56.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|