About 1-ethyl-7aH-indol-1-ium
1-ethyl-7aH-indol-1-ium (PubChem CID 155692510) has the molecular formula C10H12N+
and a molecular weight of 146.21 g/mol. Its IUPAC name is 1-ethyl-7aH-indol-1-ium.
Molecular Properties
| Compound Name | 1-ethyl-7aH-indol-1-ium |
| PubChem CID | 155692510 |
| Molecular Formula | C10H12N+ |
| Molecular Weight | 146.21 g/mol |
| Exact Mass | 146.10 |
| IUPAC Name | 1-ethyl-7aH-indol-1-ium |
| SMILES | CC[N+]1=CC=C2C=CC=CC21 |
| InChI | InChI=1S/C10H12N/c1-2-11-8-7-9-5-3-4-6-10(9)11/h3-8,10H,2H2,1H3/q+1 |
| InChIKey | YFQMBVGUEKONKX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-7aH-indol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-7aH-indol-1-ium?
The IUPAC name of 1-ethyl-7aH-indol-1-ium (CID 155692510) is 1-ethyl-7aH-indol-1-ium.
What is the SMILES notation for 1-ethyl-7aH-indol-1-ium?
The canonical SMILES for 1-ethyl-7aH-indol-1-ium is CC[N+]1=CC=C2C=CC=CC21.
What is the InChIKey of 1-ethyl-7aH-indol-1-ium?
The InChIKey is YFQMBVGUEKONKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N/c1-2-11-8-7-9-5-3-4-6-10(9)11/h3-8,10H,2H2,1H3/q+1.
What are the key properties of 1-ethyl-7aH-indol-1-ium?
1-ethyl-7aH-indol-1-ium has a molecular weight of 146.21 g/mol, XLogP of 1.52, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-7aH-indol-1-ium is sourced from PubChem (CID 155692510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).