About ethane;1-methyl-7aH-indol-1-ium
ethane;1-methyl-7aH-indol-1-ium (PubChem CID 155692702) has the molecular formula C11H16N+
and a molecular weight of 162.26 g/mol. Its IUPAC name is ethane;1-methyl-7aH-indol-1-ium.
Molecular Properties
| Compound Name | ethane;1-methyl-7aH-indol-1-ium |
| PubChem CID | 155692702 |
| Molecular Formula | C11H16N+ |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | ethane;1-methyl-7aH-indol-1-ium |
| SMILES | CC.C[N+]1=CC=C2C=CC=CC21 |
| InChI | InChI=1S/C9H10N.C2H6/c1-10-7-6-8-4-2-3-5-9(8)10;1-2/h2-7,9H,1H3;1-2H3/q+1; |
| InChIKey | VNMSUQYXIOYBRI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-methyl-7aH-indol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-7aH-indol-1-ium?
The IUPAC name of ethane;1-methyl-7aH-indol-1-ium (CID 155692702) is ethane;1-methyl-7aH-indol-1-ium.
What is the SMILES notation for ethane;1-methyl-7aH-indol-1-ium?
The canonical SMILES for ethane;1-methyl-7aH-indol-1-ium is CC.C[N+]1=CC=C2C=CC=CC21.
What is the InChIKey of ethane;1-methyl-7aH-indol-1-ium?
The InChIKey is VNMSUQYXIOYBRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N.C2H6/c1-10-7-6-8-4-2-3-5-9(8)10;1-2/h2-7,9H,1H3;1-2H3/q+1;.
What are the key properties of ethane;1-methyl-7aH-indol-1-ium?
ethane;1-methyl-7aH-indol-1-ium has a molecular weight of 162.26 g/mol, XLogP of 2.16, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-7aH-indol-1-ium is sourced from PubChem (CID 155692702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).