C17H18N4O3 — CID 155694044
1-(5-ethyl-2-methoxyphenyl)-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)urea (PubChem CID 155694044) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is 1-(5-ethyl-2-methoxyphenyl)-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)urea.
| Compound Name | 1-(5-ethyl-2-methoxyphenyl)-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)urea |
|---|---|
| PubChem CID | 155694044 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 1-(5-ethyl-2-methoxyphenyl)-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)urea |
| SMILES | CCc1ccc(OC)c(NC(=O)Nc2ccc3[nH]c(=O)[nH]c3c2)c1 |
| InChI | InChI=1S/C17H18N4O3/c1-3-10-4-7-15(24-2)14(8-10)21-16(22)18-11-5-6-12-13(9-11)20-17(23)19-12/h4-9H,3H2,1-2H3,(H2,18,21,22)(H2,19,20,23) |
| InChIKey | HGQNQQSQZQWGLX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 99.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |