C24H26ClF3N2O2 — CID 155697275
2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-N-[3-nitro-5-(trifluoromethyl)phenyl]aniline (PubChem CID 155697275) has the molecular formula C24H26ClF3N2O2 and a molecular weight of 466.93 g/mol. Its IUPAC name is 2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-N-[3-nitro-5-(trifluoromethyl)phenyl]aniline.
| Compound Name | 2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-N-[3-nitro-5-(trifluoromethyl)phenyl]aniline |
|---|---|
| PubChem CID | 155697275 |
| Molecular Formula | C24H26ClF3N2O2 |
| Molecular Weight | 466.93 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-N-[3-nitro-5-(trifluoromethyl)phenyl]aniline |
| SMILES | CC1CC2CC(C1)CC(C)(c1ccc(Nc3cc([N+](=O)[O-])cc(C(F)(F)F)c3)c(Cl)c1)C2 |
| InChI | InChI=1S/C24H26ClF3N2O2/c1-14-5-15-7-16(6-14)13-23(2,12-15)17-3-4-22(21(25)10-17)29-19-8-18(24(26,27)28)9-20(11-19)30(31)32/h3-4,8-11,14-16,29H,5-7,12-13H2,1-2H3 |
| InChIKey | GHFAWRBCWHMOTP-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.93 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|