C30H40ClN3O3 — CID 155697299
N-[4-[2-chloro-4-(3-ethyl-3-bicyclo[3.3.1]nonanyl)anilino]phenyl]pyrrolidine-1-carboxamide;methyl formate (PubChem CID 155697299) has the molecular formula C30H40ClN3O3 and a molecular weight of 526.12 g/mol. Its IUPAC name is N-[4-[2-chloro-4-(3-ethyl-3-bicyclo[3.3.1]nonanyl)anilino]phenyl]pyrrolidine-1-carboxamide;methyl formate.
| Compound Name | N-[4-[2-chloro-4-(3-ethyl-3-bicyclo[3.3.1]nonanyl)anilino]phenyl]pyrrolidine-1-carboxamide;methyl formate |
|---|---|
| PubChem CID | 155697299 |
| Molecular Formula | C30H40ClN3O3 |
| Molecular Weight | 526.12 g/mol |
| Exact Mass | 525.28 |
| IUPAC Name | N-[4-[2-chloro-4-(3-ethyl-3-bicyclo[3.3.1]nonanyl)anilino]phenyl]pyrrolidine-1-carboxamide;methyl formate |
| SMILES | CCC1(c2ccc(Nc3ccc(NC(=O)N4CCCC4)cc3)c(Cl)c2)CC2CCCC(C2)C1.COC=O |
| InChI | InChI=1S/C28H36ClN3O.C2H4O2/c1-2-28(18-20-6-5-7-21(16-20)19-28)22-8-13-26(25(29)17-22)30-23-9-11-24(12-10-23)31-27(33)32-14-3-4-15-32;1-4-2-3/h8-13,17,20-21,30H,2-7,14-16,18-19H2,1H3,(H,31,33);2H,1H3 |
| InChIKey | KXZRMQHVNOSGRQ-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.12 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|