C29H38ClN3O3 — CID 155697191
N-[4-[2-chloro-4-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)anilino]phenyl]pyrrolidine-1-carboxamide;formic acid (PubChem CID 155697191) has the molecular formula C29H38ClN3O3 and a molecular weight of 512.09 g/mol. Its IUPAC name is N-[4-[2-chloro-4-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)anilino]phenyl]pyrrolidine-1-carboxamide;formic acid.
| Compound Name | N-[4-[2-chloro-4-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)anilino]phenyl]pyrrolidine-1-carboxamide;formic acid |
|---|---|
| PubChem CID | 155697191 |
| Molecular Formula | C29H38ClN3O3 |
| Molecular Weight | 512.09 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | N-[4-[2-chloro-4-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)anilino]phenyl]pyrrolidine-1-carboxamide;formic acid |
| SMILES | CC1CC2CC(C)CC(c3ccc(Nc4ccc(NC(=O)N5CCCC5)cc4)c(Cl)c3)(C1)C2.O=CO |
| InChI | InChI=1S/C28H36ClN3O.CH2O2/c1-19-13-21-14-20(2)17-28(16-19,18-21)22-5-10-26(25(29)15-22)30-23-6-8-24(9-7-23)31-27(33)32-11-3-4-12-32;2-1-3/h5-10,15,19-21,30H,3-4,11-14,16-18H2,1-2H3,(H,31,33);1H,(H,2,3) |
| InChIKey | NFGRCSHBOXTFES-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.09 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|