C18H23F2NO3 — CID 155699935
tert-butyl (3E)-3-butylidene-7,8-difluoro-4H-1,5-benzoxazepine-5-carboxylate (PubChem CID 155699935) has the molecular formula C18H23F2NO3 and a molecular weight of 339.38 g/mol. Its IUPAC name is tert-butyl (3E)-3-butylidene-7,8-difluoro-4H-1,5-benzoxazepine-5-carboxylate.
| Compound Name | tert-butyl (3E)-3-butylidene-7,8-difluoro-4H-1,5-benzoxazepine-5-carboxylate |
|---|---|
| PubChem CID | 155699935 |
| Molecular Formula | C18H23F2NO3 |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | tert-butyl (3E)-3-butylidene-7,8-difluoro-4H-1,5-benzoxazepine-5-carboxylate |
| SMILES | CCC/C=C1/COc2cc(F)c(F)cc2N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H23F2NO3/c1-5-6-7-12-10-21(17(22)24-18(2,3)4)15-8-13(19)14(20)9-16(15)23-11-12/h7-9H,5-6,10-11H2,1-4H3/b12-7+ |
| InChIKey | BJFFDIUTEWPKNA-KPKJPENVSA-N |
| XLogP | 4.83 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|